Difference between revisions of "Ec-07 007360"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] == * smiles: ** C(C(C(C([O-])=O)=O)O...")
(Created page with "Category:Gene == Gene Ec-07_007360 == * left end position: ** 7077551 * transcription direction: ** NEGATIVE * right end position: ** 7086267 * centisome position: ** 91.6...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] ==
+
== Gene Ec-07_007360 ==
−
* smiles:
+
* left end position:
−
** C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]
+
** 7077551
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate
+
** 7086267
−
* molecular weight:
+
* centisome position:
−
** 211.045    
+
** 91.64928    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-4-phospho-hydroxy-α-ketobutyrate
+
** Esi_0305_0010
−
** 2-oxo-3-hydroxy-4-phosphobutanoate
+
** Esi0305_0010
 +
** P5CR
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PYRROLINECARBREDUCT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[PSERTRANSAMPYR-RXN]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN66-546]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PROSYN-PWY]]
 +
* [[ARG-PRO-PWY]]
 +
* [[PWY-6344]]
 +
* [[PWY-4981]]
 +
* [[PWY-3341]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=7077551}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06054 C06054]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=7086267}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58538 58538]
+
{{#set: centisome position=91.64928   }}
−
* BIGG : 1447403
+
{{#set: common name=Esi_0305_0010|Esi0305_0010|P5CR}}
−
* PUBCHEM:
+
{{#set: reaction associated=PYRROLINECARBREDUCT-RXN|RXN66-546}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266680 45266680]
+
{{#set: pathway associated=PROSYN-PWY|ARG-PRO-PWY|PWY-6344|PWY-4981|PWY-3341}}
−
* HMDB : HMDB06801
+
−
{{#set: smiles=C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K}}
+
−
{{#set: common name=(3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate}}
+
−
{{#set: molecular weight=211.045   }}
+
−
{{#set: common name=3-hydroxy-4-phospho-hydroxy-α-ketobutyrate|2-oxo-3-hydroxy-4-phosphobutanoate}}
+
−
{{#set: reversible reaction associated=PSERTRANSAMPYR-RXN}}
+

Latest revision as of 19:41, 21 March 2018

Gene Ec-07_007360

  • left end position:
    • 7077551
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 7086267
  • centisome position:
    • 91.64928
  • Synonym(s):
    • Esi_0305_0010
    • Esi0305_0010
    • P5CR

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_007360&oldid=28739"