Difference between revisions of "RXN1G-368"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-368 RXN1G-368] == * direction: ** LEFT-TO-RIGHT * common name: ** Thiolase-like, subgroup **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-368 RXN1G-368] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Thiolase-like, subgroup |
− | * | + | ** Beta-ketoacyl synthase, N-terminal |
− | ** | + | ** beta-ketoacyl synthase, partial |
+ | ** 3-oxoacyl-[acyl-carrier-protein] synthase | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[Stearoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[MALONYL-COA]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-oxo-arachidoyl-ACPs]][c] '''+''' 1 [[CO-A]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a stearoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 malonyl-CoA[c] '''=>''' 1 CO2[c] '''+''' 1 a 3-oxo-arachidoyl-[acp][c] '''+''' 1 coenzyme A[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-27_002090]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-12_000640]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-12_000650]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-27_003480]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
+ | ** '''30''' reactions found over '''182''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Thiolase-like, subgroup}} | |
− | + | {{#set: common name=Beta-ketoacyl synthase, N-terminal}} | |
− | + | {{#set: common name=beta-ketoacyl synthase, partial}} | |
− | + | {{#set: common name=3-oxoacyl-[acyl-carrier-protein] synthase}} | |
− | + | {{#set: ec number=EC-2.3.1.41}} | |
− | + | {{#set: gene associated=Ec-27_002090|Ec-12_000640|Ec-12_000650|Ec-27_003480}} | |
− | + | {{#set: in pathway=PWYG-321}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: common name= | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:41, 21 March 2018
Contents
Reaction RXN1G-368
- direction:
- LEFT-TO-RIGHT
- common name:
- Thiolase-like, subgroup
- Beta-ketoacyl synthase, N-terminal
- beta-ketoacyl synthase, partial
- 3-oxoacyl-[acyl-carrier-protein] synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Stearoyl-ACPs[c] + 1 PROTON[c] + 1 MALONYL-COA[c] => 1 CARBON-DIOXIDE[c] + 1 3-oxo-arachidoyl-ACPs[c] + 1 CO-A[c]
- With common name(s):
- 1 a stearoyl-[acp][c] + 1 H+[c] + 1 malonyl-CoA[c] => 1 CO2[c] + 1 a 3-oxo-arachidoyl-[acp][c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_002090
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-12_000640
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-12_000650
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-27_003480
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
"3-oxoacyl-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.