Difference between revisions of "Ec-10 004630"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-UREIDO-ISOBUTYRATE 3-UREIDO-ISOBUTYRATE] == * smiles: ** CC(CNC(N)=O)C(=O)[O-] * inchi key: *...")
(Created page with "Category:Gene == Gene Ec-10_004630 == * left end position: ** 4769111 * transcription direction: ** NEGATIVE * right end position: ** 4788876 * centisome position: ** 73.3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-UREIDO-ISOBUTYRATE 3-UREIDO-ISOBUTYRATE] ==
+
== Gene Ec-10_004630 ==
−
* smiles:
+
* left end position:
−
** CC(CNC(N)=O)C(=O)[O-]
+
** 4769111
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PHENTZNALBMCQD-GSVOUGTGSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (R)-3-ureido-isobutanoate
+
** 4788876
−
* molecular weight:
+
* centisome position:
−
** 145.138    
+
** 73.359825    
 
* Synonym(s):
 
* Synonym(s):
−
** N-carbamyl-β-aminoisobutyric acid
+
** Esi_0183_0003
−
** N-carbamyl-β-aminoisobutyrate
+
** Esi0183_0003
−
** (R)-3-ureido-isobutyrate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11210]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4769111}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820371 91820371]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=4788876}}
−
** [http://www.chemspider.com/Chemical-Structure.19988990.html 19988990]
+
{{#set: centisome position=73.359825   }}
−
* CHEBI:
+
{{#set: common name=Esi_0183_0003|Esi0183_0003}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74414 74414]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C05100 C05100]
+
−
* HMDB : HMDB02031
+
−
{{#set: smiles=CC(CNC(N)=O)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=PHENTZNALBMCQD-GSVOUGTGSA-M}}
+
−
{{#set: common name=(R)-3-ureido-isobutanoate}}
+
−
{{#set: molecular weight=145.138   }}
+
−
{{#set: common name=N-carbamyl-β-aminoisobutyric acid|N-carbamyl-β-aminoisobutyrate|(R)-3-ureido-isobutyrate}}
+
−
{{#set: consumed by=RXN-11210}}
+

Latest revision as of 20:41, 21 March 2018

Gene Ec-10_004630

  • left end position:
    • 4769111
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4788876
  • centisome position:
    • 73.359825
  • Synonym(s):
    • Esi_0183_0003
    • Esi0183_0003

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_004630&oldid=28751"