Difference between revisions of "Ec-08 005610"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C(=O)[O-])C(C([O-])=O)O * inchi key: ** InChIKey=JUCRENB...") |
(Created page with "Category:Gene == Gene Ec-08_005610 == * left end position: ** 5357417 * transcription direction: ** NEGATIVE * right end position: ** 5373251 * centisome position: ** 79.9...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_005610 == |
− | * | + | * left end position: |
− | ** | + | ** 5357417 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5373251 |
− | * | + | * centisome position: |
− | ** | + | ** 79.996475 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0005_0245 | ||
+ | ** Esi0005_0245 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[ATPASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5357417}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5373251}} | |
− | + | {{#set: centisome position=79.996475 }} | |
− | + | {{#set: common name=Esi_0005_0245|Esi0005_0245}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:42, 21 March 2018
Gene Ec-08_005610
- left end position:
- 5357417
- transcription direction:
- NEGATIVE
- right end position:
- 5373251
- centisome position:
- 79.996475
- Synonym(s):
- Esi_0005_0245
- Esi0005_0245
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome