Difference between revisions of "RXN490-3641"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] == * smiles: ** CC1([N+](=CSC(CCOP([O-])(=O)[O-])=1)CC2(C=NC(C)=NC(N)=2)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN490-3641 RXN490-3641] == * direction: ** LEFT-TO-RIGHT * common name: ** proline,2-oxoglutarate-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN490-3641 RXN490-3641] ==
−
* smiles:
+
* direction:
−
** CC1([N+](=CSC(CCOP([O-])(=O)[O-])=1)CC2(C=NC(C)=NC(N)=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HZSAJDVWZRBGIF-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** thiamine phosphate
+
** proline,2-oxoglutarate-4-dioxygenase (cis-4-hydroxy-L-proline)
−
* molecular weight:
+
* ec number:
−
** 343.317   
+
** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11]
 
* Synonym(s):
 
* Synonym(s):
−
** TMP
+
** prolyl hydroxylase
−
** thiamin monophosphate
+
** prolyl 4-hydroxylase
−
** thiamin phosphate
+
** proline,2-oxoglutarate 4-dioxygenase
−
** thiamin-P
+
** proline hydroxylase
−
** thiamine-Pi
+
** protocollagen hydroxylase
−
** ThP
+
−
** thiamine monophosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[THI-P-SYN-RXN]]
+
** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PRO]][c] '''=>''' 1 [[4-HYDROXY-L-PROLINE]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN0-3542]]
+
** 1 2-oxoglutarate[c] '''+''' 1 oxygen[c] '''+''' 1 L-proline[c] '''=>''' 1 trans-4-hydroxy-L-proline[c] '''+''' 1 succinate[c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-07_001070]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-08_002170]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 532-40-1
+
* LIGAND-RXN:
−
* BIGG : 36768
+
** [http://www.genome.jp/dbget-bin/www_bget?R01252 R01252]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15942892 15942892]
+
{{#set: common name=proline,2-oxoglutarate-4-dioxygenase (cis-4-hydroxy-L-proline)}}
−
* HMDB : HMDB02666
+
{{#set: ec number=EC-1.14.11}}
−
* LIGAND-CPD:
+
{{#set: common name=prolyl hydroxylase|prolyl 4-hydroxylase|proline,2-oxoglutarate 4-dioxygenase|proline hydroxylase|protocollagen hydroxylase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01081 C01081]
+
{{#set: gene associated=Ec-07_001070|Ec-08_002170}}
−
* CHEMSPIDER:
+
{{#set: in pathway=}}
−
** [http://www.chemspider.com/Chemical-Structure.13085545.html 13085545]
+
{{#set: reconstruction category=orthology}}
−
* CHEBI:
+
{{#set: reconstruction source=orthology-aragem}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37575 37575]
+
{{#set: reconstruction tool=pantograph}}
−
* METABOLIGHTS : MTBLC37575
+
−
{{#set: smiles=CC1([N+](=CSC(CCOP([O-])(=O)[O-])=1)CC2(C=NC(C)=NC(N)=2))}}
+
−
{{#set: inchi key=InChIKey=HZSAJDVWZRBGIF-UHFFFAOYSA-M}}
+
−
{{#set: common name=thiamine phosphate}}
+
−
{{#set: molecular weight=343.317    }}
+
−
{{#set: common name=TMP|thiamin monophosphate|thiamin phosphate|thiamin-P|thiamine-Pi|ThP|thiamine monophosphate}}
+
−
{{#set: produced by=THI-P-SYN-RXN}}
+
−
{{#set: reversible reaction associated=RXN0-3542}}
+

Latest revision as of 19:42, 21 March 2018

Reaction RXN490-3641

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • proline,2-oxoglutarate-4-dioxygenase (cis-4-hydroxy-L-proline)
  • ec number:
  • Synonym(s):
    • prolyl hydroxylase
    • prolyl 4-hydroxylase
    • proline,2-oxoglutarate 4-dioxygenase
    • proline hydroxylase
    • protocollagen hydroxylase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN490-3641&oldid=28806"