Difference between revisions of "CPD-11020"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == * smiles: ** C(=O)([O-])C(=O)CC(O)CCl * inchi key: ** InChIKey=FHWPHVIG...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(=O)([O-])C(=O)CC(O)CCl |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M |
* common name: | * common name: | ||
− | ** | + | ** 5-chloro-4-hydroxy-2-oxopentanoate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 165.553 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-chloro-4-hydroxy-2-oxovalerate |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11717]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580] |
− | + | {{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}} | |
− | + | {{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}} | |
− | + | {{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=165.553 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-11717}} |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: produced by=RXN- | + |
Latest revision as of 19:42, 21 March 2018
Contents
Metabolite CPD-11020
- smiles:
- C(=O)([O-])C(=O)CC(O)CCl
- inchi key:
- InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
- common name:
- 5-chloro-4-hydroxy-2-oxopentanoate
- molecular weight:
- 165.553
- Synonym(s):
- 5-chloro-4-hydroxy-2-oxovalerate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])C(=O)CC(O)CCl" cannot be used as a page name in this wiki.