Difference between revisions of "CPD-1130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-774 CPD1G-774] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCCCCCCC(C(=O)OCC2(C(O)C(O)C(O)C(OC1(C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C(=O)[O-])C(C([O-])=O)O * inchi key: ** InChIKey=JUCRENB...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCC(C(=O)[O-])C(C([O-])=O)O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 3-ethylmalate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 160.126 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14986]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145023 21145023] |
| − | {{#set: smiles= | + | * CHEMSPIDER: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.chemspider.com/Chemical-Structure.20015785.html 20015785] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57425 57425] |
| − | {{#set: consumed by= | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01989 C01989] | ||
| + | {{#set: smiles=CCC(C(=O)[O-])C(C([O-])=O)O}} | ||
| + | {{#set: inchi key=InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=3-ethylmalate}} | ||
| + | {{#set: molecular weight=160.126 }} | ||
| + | {{#set: consumed by=RXN-14986}} | ||
Latest revision as of 19:42, 21 March 2018
Contents
Metabolite CPD-1130
- smiles:
- CCC(C(=O)[O-])C(C([O-])=O)O
- inchi key:
- InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L
- common name:
- 3-ethylmalate
- molecular weight:
- 160.126
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(C(=O)[O-])C(C([O-])=O)O" cannot be used as a page name in this wiki.
