Difference between revisions of "CPD0-1083"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLT-tRNAs GLT-tRNAs] == * common name: ** a tRNAglu * Synonym(s): ** TRNA(GLT) ** tRNAglt == R...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)O * inchi key: ** InChIKey=RGH...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLT-tRNAs GLT-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] ==
 +
* smiles:
 +
** C(C(C(C(C(C([O-])=O)O)O)O)O)O
 +
* inchi key:
 +
** InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M
 
* common name:
 
* common name:
** a tRNAglu
+
** aldehydo-L-galactonate
 +
* molecular weight:
 +
** 195.149   
 
* Synonym(s):
 
* Synonym(s):
** TRNA(GLT)
 
** tRNAglt
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLURS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTRNAREDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-11152]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a tRNAglu}}
+
* PUBCHEM:
{{#set: common name=TRNA(GLT)|tRNAglt}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229140 44229140]
{{#set: consumed by=GLURS-RXN}}
+
* CHEBI:
{{#set: produced by=GLUTRNAREDUCT-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53071 53071]
 +
* BIGG : 3138483
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?c15930 c15930]
 +
{{#set: smiles=C(C(C(C(C(C([O-])=O)O)O)O)O)O}}
 +
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M}}
 +
{{#set: common name=aldehydo-L-galactonate}}
 +
{{#set: molecular weight=195.149    }}
 +
{{#set: reversible reaction associated=RXN-11152}}

Latest revision as of 19:10, 21 March 2018

Metabolite CPD0-1083

  • smiles:
    • C(C(C(C(C(C([O-])=O)O)O)O)O)O
  • inchi key:
    • InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M
  • common name:
    • aldehydo-L-galactonate
  • molecular weight:
    • 195.149
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(C(C(C(C([O-])=O)O)O)O)O)O" cannot be used as a page name in this wiki.