Difference between revisions of "CPD0-1083"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLT-tRNAs GLT-tRNAs] == * common name: ** a tRNAglu * Synonym(s): ** TRNA(GLT) ** tRNAglt == R...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)O * inchi key: ** InChIKey=RGH...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] == |
+ | * smiles: | ||
+ | ** C(C(C(C(C(C([O-])=O)O)O)O)O)O | ||
+ | * inchi key: | ||
+ | ** InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** aldehydo-L-galactonate |
+ | * molecular weight: | ||
+ | ** 195.149 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-11152]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229140 44229140] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53071 53071] |
+ | * BIGG : 3138483 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?c15930 c15930] | ||
+ | {{#set: smiles=C(C(C(C(C(C([O-])=O)O)O)O)O)O}} | ||
+ | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M}} | ||
+ | {{#set: common name=aldehydo-L-galactonate}} | ||
+ | {{#set: molecular weight=195.149 }} | ||
+ | {{#set: reversible reaction associated=RXN-11152}} |
Latest revision as of 19:10, 21 March 2018
Contents
Metabolite CPD0-1083
- smiles:
- C(C(C(C(C(C([O-])=O)O)O)O)O)O
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-RSJOWCBRSA-M
- common name:
- aldehydo-L-galactonate
- molecular weight:
- 195.149
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(C(C(C(C([O-])=O)O)O)O)O)O" cannot be used as a page name in this wiki.