Difference between revisions of "FADH2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Aldehydes Long-Chain-Aldehydes] == * common name: ** a long-chain aldehyde * Synonym...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] == * smiles: ** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] == |
+ | * smiles: | ||
+ | ** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** FADH2 |
+ | * molecular weight: | ||
+ | ** 785.556 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** flavin adenine dinucleotide reduced |
+ | ** 1,5-dihydro-FAD | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[MEPROPCOA-FAD-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN-14264]] |
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 1910-41-4 |
− | {{#set: common name= | + | * Wikipedia : Flavin_adenine_dinucleotide |
− | {{#set: reversible reaction associated= | + | * BIGG : 132077 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931118 46931118] | ||
+ | * HMDB : HMDB01197 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01352 C01352] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58307 58307] | ||
+ | * METABOLIGHTS : MTBLC58307 | ||
+ | {{#set: smiles=CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))}} | ||
+ | {{#set: inchi key=InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L}} | ||
+ | {{#set: common name=FADH2}} | ||
+ | {{#set: molecular weight=785.556 }} | ||
+ | {{#set: common name=flavin adenine dinucleotide reduced|1,5-dihydro-FAD}} | ||
+ | {{#set: produced by=MEPROPCOA-FAD-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-14264}} |
Latest revision as of 19:42, 21 March 2018
Contents
Metabolite FADH2
- smiles:
- CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))
- inchi key:
- InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L
- common name:
- FADH2
- molecular weight:
- 785.556
- Synonym(s):
- flavin adenine dinucleotide reduced
- 1,5-dihydro-FAD
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1910-41-4
- Wikipedia : Flavin_adenine_dinucleotide
- BIGG : 132077
- PUBCHEM:
- HMDB : HMDB01197
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58307
"CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))" cannot be used as a page name in this wiki.