Difference between revisions of "CD-S-SP-Complex"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == * smiles: ** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CD-S-SP-Complex CD-S-SP-Complex] == * common name: ** a [cysteine desulfurase]-S-sulfanyl-[diso...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CD-S-SP-Complex CD-S-SP-Complex] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [cysteine desulfurase]-S-sulfanyl-[disordered-form scaffold protein] complex |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-14385]] | |
| − | * [[RXN- | + | |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14384]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [cysteine desulfurase]-S-sulfanyl-[disordered-form scaffold protein] complex}} | |
| − | + | {{#set: consumed by=RXN-14385}} | |
| − | + | {{#set: produced by=RXN-14384}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | {{#set: | + | |
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite CD-S-SP-Complex
- common name:
- a [cysteine desulfurase]-S-sulfanyl-[disordered-form scaffold protein] complex
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [cysteine desulfurase]-S-sulfanyl-[disordered-form scaffold protein] complex" cannot be used as a page name in this wiki.
