Difference between revisions of "2-ALPHA-HYDROXYETHYL-THPP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14179 RXN-14179] == * direction: ** LEFT-TO-RIGHT * common name: ** Beta-glucosidase, family GH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == |
− | * | + | * smiles: |
− | ** | + | ** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-]) |
+ | * inchi key: | ||
+ | ** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 2-(α-hydroxyethyl)thiamine diphosphate |
− | + | * molecular weight: | |
− | * | + | ** 466.341 |
− | + | ||
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-(α-hydroxyethyl)-TPP | ||
+ | ** 2-(α-hydroxyethyl)-ThPP | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-12508]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-12583]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939] |
− | {{#set: | + | {{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}} |
− | {{#set: | + | {{#set: common name=2-(α-hydroxyethyl)thiamine diphosphate}} |
− | {{#set: | + | {{#set: molecular weight=466.341 }} |
− | + | {{#set: common name=2-(α-hydroxyethyl)-TPP|2-(α-hydroxyethyl)-ThPP}} | |
− | + | {{#set: consumed by=RXN-12508}} | |
+ | {{#set: produced by=RXN-12583}} |
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite 2-ALPHA-HYDROXYETHYL-THPP
- smiles:
- CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
- inchi key:
- InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
- common name:
- 2-(α-hydroxyethyl)thiamine diphosphate
- molecular weight:
- 466.341
- Synonym(s):
- 2-(α-hydroxyethyl)-TPP
- 2-(α-hydroxyethyl)-ThPP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])" cannot be used as a page name in this wiki.