Difference between revisions of "THIOPURINE-S-METHYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * inchi key: ** InChIKey=KQR...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIOPURINE-S-METHYLTRANSFERASE-RXN THIOPURINE-S-METHYLTRANSFERASE-RXN] == * direction: ** LEFT-TO-R...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIOPURINE-S-METHYLTRANSFERASE-RXN THIOPURINE-S-METHYLTRANSFERASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** thiopurine S-methyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.1.1.67 EC-2.1.1.67] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[Thiopurines]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[Thiopurine-Methylethers]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a thiopurine[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 a thiopurine S-methylether[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-09_003500]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-18_001620]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03701 R03701] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=thiopurine S-methyltransferase}} | |
− | + | {{#set: ec number=EC-2.1.1.67}} | |
− | {{#set: | + | {{#set: gene associated=Ec-09_003500|Ec-18_001620}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + |
Latest revision as of 19:43, 21 March 2018
Contents
Reaction THIOPURINE-S-METHYLTRANSFERASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- thiopurine S-methyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Thiopurines[c] + 1 S-ADENOSYLMETHIONINE[c] => 1 ADENOSYL-HOMO-CYS[c] + 1 Thiopurine-Methylethers[c] + 1 PROTON[c]
- With common name(s):
- 1 a thiopurine[c] + 1 S-adenosyl-L-methionine[c] => 1 S-adenosyl-L-homocysteine[c] + 1 a thiopurine S-methylether[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-09_003500
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-18_001620
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN: