Difference between revisions of "GDP-TP"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_004860 == * left end position: ** 4490604 * transcription direction: ** NEGATIVE * right end position: ** 4496951 * centisome position: ** 53.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H |
− | * | + | * common name: |
− | ** | + | ** pppGpp |
− | * | + | * molecular weight: |
− | ** | + | ** 677.095 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** guanosine pentaphosphate |
− | ** | + | ** guanosine 3'-diphosphate 5'-triphosphate |
− | ** | + | ** guanosine 5'-triphosphate,3'-diphosphate |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[GTPPYPHOSKIN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04494 C04494] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16690 16690] |
− | {{#set: common name= | + | * BIGG : 43927 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173549 46173549] | ||
+ | * HMDB : HMDB60480 | ||
+ | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
+ | {{#set: inchi key=InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H}} | ||
+ | {{#set: common name=pppGpp}} | ||
+ | {{#set: molecular weight=677.095 }} | ||
+ | {{#set: common name=guanosine pentaphosphate|guanosine 3'-diphosphate 5'-triphosphate|guanosine 5'-triphosphate,3'-diphosphate}} | ||
+ | {{#set: produced by=GTPPYPHOSKIN-RXN}} |
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite GDP-TP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- inchi key:
- InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
- common name:
- pppGpp
- molecular weight:
- 677.095
- Synonym(s):
- guanosine pentaphosphate
- guanosine 3'-diphosphate 5'-triphosphate
- guanosine 5'-triphosphate,3'-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.