Difference between revisions of "CPD-11671"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9787 RXN-9787] == * direction: ** REVERSIBLE * common name: ** cysteine:[ThiI sulfur-carrier pr...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * inchi key: ** InChIKey=KQR...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) |
| + | * inchi key: | ||
| + | ** InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 5-hydroxytryptophol |
| − | * | + | * molecular weight: |
| − | + | ** 177.202 | |
| − | + | ||
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| + | ** hydroxytryptophol | ||
| + | ** 5-hydroxyindole-3-ethanol | ||
| + | ** 5-hydroxy-1H-indole-3-ethanol | ||
| + | ** 1H-indole-3-ethanol, 5-hydroxy- | ||
| + | ** indole-3-ethanol, 5-hydroxy- | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10782]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9061 9061] | |
| − | + | * CHEMSPIDER: | |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.8708.html 8708] |
| − | + | * HMDB : HMDB01855 | |
| − | {{#set: | + | {{#set: smiles=C(O)CC1(=CNC2(=C1C=C(O)C=C2))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: common name=5-hydroxytryptophol}} |
| − | {{#set: | + | {{#set: molecular weight=177.202 }} |
| − | {{#set: | + | {{#set: common name=hydroxytryptophol|5-hydroxyindole-3-ethanol|5-hydroxy-1H-indole-3-ethanol|1H-indole-3-ethanol, 5-hydroxy-|indole-3-ethanol, 5-hydroxy-}} |
| + | {{#set: consumed by=RXN-10782}} | ||
Latest revision as of 19:43, 21 March 2018
Contents
Metabolite CPD-11671
- smiles:
- C(O)CC1(=CNC2(=C1C=C(O)C=C2))
- inchi key:
- InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N
- common name:
- 5-hydroxytryptophol
- molecular weight:
- 177.202
- Synonym(s):
- hydroxytryptophol
- 5-hydroxyindole-3-ethanol
- 5-hydroxy-1H-indole-3-ethanol
- 1H-indole-3-ethanol, 5-hydroxy-
- indole-3-ethanol, 5-hydroxy-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
