Difference between revisions of "Ec-26 006330"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == * smiles: ** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Ec-26_006330 == * left end position: ** 6338097 * transcription direction: ** POSITIVE * right end position: ** 6344560 * centisome position: ** 96.2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] ==
+
== Gene Ec-26_006330 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 6338097
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (7Z)-tetradecenoyl-CoA
+
** 6344560
−
* molecular weight:
+
* centisome position:
−
** 971.845    
+
** 96.27467    
 
* Synonym(s):
 
* Synonym(s):
−
** 14:1-Δ7-CoA
+
** Esi_0059_0005
−
** cis-7-tetradecenoyl-CoA
+
** Esi0059_0005
−
** 14:1(n-7)-CoA
+
−
** (7Z)-tetradec-7-enoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17792]]
+
* Reaction: [[3.4.25.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=6338097}}
−
{{#set: inchi key=InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(7Z)-tetradecenoyl-CoA}}
+
{{#set: right end position=6344560}}
−
{{#set: molecular weight=971.845   }}
+
{{#set: centisome position=96.27467   }}
−
{{#set: common name=14:1-Δ7-CoA|cis-7-tetradecenoyl-CoA|14:1(n-7)-CoA|(7Z)-tetradec-7-enoyl-CoA}}
+
{{#set: common name=Esi_0059_0005|Esi0059_0005}}
−
{{#set: consumed by=RXN-17792}}
+
{{#set: reaction associated=3.4.25.1-RXN}}

Latest revision as of 19:43, 21 March 2018

Gene Ec-26_006330

  • left end position:
    • 6338097
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6344560
  • centisome position:
    • 96.27467
  • Synonym(s):
    • Esi_0059_0005
    • Esi0059_0005

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_006330&oldid=28970"