Difference between revisions of "Ec-08 004630"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...") |
(Created page with "Category:Gene == Gene Ec-08_004630 == * Synonym(s): ** Esi_0315_0030 ** Esi0315_0030 == Reactions associated == * Reaction: PHOSMANMUT-RXN ** Source: orthology-arag...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_004630 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0315_0030 |
− | ** | + | ** Esi0315_0030 |
− | + | ||
− | == | + | == Reactions associated == |
− | == | + | * Reaction: [[PHOSMANMUT-RXN]] |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-7456]] | |
+ | * [[PWY-5659]] | ||
+ | * [[PWY-882]] | ||
+ | * [[PWY-7586]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0315_0030|Esi0315_0030}} | |
− | + | {{#set: reaction associated=PHOSMANMUT-RXN}} | |
− | + | {{#set: pathway associated=PWY-7456|PWY-5659|PWY-882|PWY-7586}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:43, 21 March 2018
Gene Ec-08_004630
- Synonym(s):
- Esi_0315_0030
- Esi0315_0030
Reactions associated
- Reaction: PHOSMANMUT-RXN
- Source: orthology-aragem