Difference between revisions of "4-PRENYLPHLORISOBUTYROPHENONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYRAMINE TYRAMINE] == * smiles: ** C1(C=C(O)C=CC(CC[N+])=1) * inchi key: ** InChIKey=DZGWFCGJZK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PRENYLPHLORISOBUTYROPHENONE 4-PRENYLPHLORISOBUTYROPHENONE] == * smiles: ** CC(=CCC1(=C(C=C(C(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PRENYLPHLORISOBUTYROPHENONE 4-PRENYLPHLORISOBUTYROPHENONE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** 4-prenylphlorisobutyrophenone |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 263.313 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** compound co-X |
− | + | ** PPIBP | |
− | ** | + | ** dimethylallyl-phlorisobutyrophenone |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-7813]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203134 25203134] |
− | + | {{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C}} | |
− | + | {{#set: inchi key=InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M}} | |
− | + | {{#set: common name=4-prenylphlorisobutyrophenone}} | |
− | + | {{#set: molecular weight=263.313 }} | |
− | + | {{#set: common name=compound co-X|PPIBP|dimethylallyl-phlorisobutyrophenone}} | |
− | + | {{#set: consumed by=RXN-7813}} | |
− | + | ||
− | + | ||
− | {{#set: smiles= | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: consumed by=RXN- | + | |
− | + |
Latest revision as of 19:44, 21 March 2018
Contents
Metabolite 4-PRENYLPHLORISOBUTYROPHENONE
- smiles:
- CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C
- inchi key:
- InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M
- common name:
- 4-prenylphlorisobutyrophenone
- molecular weight:
- 263.313
- Synonym(s):
- compound co-X
- PPIBP
- dimethylallyl-phlorisobutyrophenone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C" cannot be used as a page name in this wiki.