Difference between revisions of "TYRAMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-mannopyranose D-mannopyranose] == * common name: ** D-mannopyranose * Synonym(s): ** carubino...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYRAMINE TYRAMINE] == * smiles: ** C1(C=C(O)C=CC(CC[N+])=1) * inchi key: ** InChIKey=DZGWFCGJZK...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYRAMINE TYRAMINE] == |
+ | * smiles: | ||
+ | ** C1(C=C(O)C=CC(CC[N+])=1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=DZGWFCGJZKJUFP-UHFFFAOYSA-O | ||
* common name: | * common name: | ||
− | ** | + | ** tyramine |
+ | * molecular weight: | ||
+ | ** 138.189 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** tyrosamine |
− | ** | + | ** 4-(2-aminoethyl)phenol |
+ | ** p-hydroxyphenethylamine | ||
+ | ** 2-(p-hydroxyphenyl)ethylamine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-5821]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[TYROSINE-DECARBOXYLASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 51-67-2 |
− | {{#set: common name= | + | * BIGG : 35110 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5249538 5249538] |
+ | * HMDB : HMDB00306 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00483 C00483] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4416910.html 4416910] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=327995 327995] | ||
+ | * METABOLIGHTS : MTBLC327995 | ||
+ | {{#set: smiles=C1(C=C(O)C=CC(CC[N+])=1)}} | ||
+ | {{#set: inchi key=InChIKey=DZGWFCGJZKJUFP-UHFFFAOYSA-O}} | ||
+ | {{#set: common name=tyramine}} | ||
+ | {{#set: molecular weight=138.189 }} | ||
+ | {{#set: common name=tyrosamine|4-(2-aminoethyl)phenol|p-hydroxyphenethylamine|2-(p-hydroxyphenyl)ethylamine}} | ||
+ | {{#set: consumed by=RXN-5821}} | ||
+ | {{#set: produced by=TYROSINE-DECARBOXYLASE-RXN}} |
Latest revision as of 19:44, 21 March 2018
Contents
Metabolite TYRAMINE
- smiles:
- C1(C=C(O)C=CC(CC[N+])=1)
- inchi key:
- InChIKey=DZGWFCGJZKJUFP-UHFFFAOYSA-O
- common name:
- tyramine
- molecular weight:
- 138.189
- Synonym(s):
- tyrosamine
- 4-(2-aminoethyl)phenol
- p-hydroxyphenethylamine
- 2-(p-hydroxyphenyl)ethylamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 51-67-2
- BIGG : 35110
- PUBCHEM:
- HMDB : HMDB00306
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC327995
"C1(C=C(O)C=CC(CC[N+])=1)" cannot be used as a page name in this wiki.