Difference between revisions of "Ec-27 004020"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) *...") |
(Created page with "Category:Gene == Gene Ec-27_004020 == * left end position: ** 3503428 * transcription direction: ** POSITIVE * right end position: ** 3513057 * centisome position: ** 54.3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_004020 == |
− | * | + | * left end position: |
− | ** | + | ** 3503428 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3513057 |
− | * | + | * centisome position: |
− | ** | + | ** 54.317497 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0000_0449 |
− | ** | + | ** Esi0000_0449 |
+ | ** IGPS | ||
− | == | + | == Reactions associated == |
− | * | + | * Reaction: [[IGPSYN-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: ec-number | |
− | + | == Pathways associated == | |
− | + | * [[TRPSYN-PWY]] | |
− | + | ||
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3503428}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3513057}} | |
− | + | {{#set: centisome position=54.317497 }} | |
− | + | {{#set: common name=Esi_0000_0449|Esi0000_0449|IGPS}} | |
− | + | {{#set: reaction associated=IGPSYN-RXN}} | |
− | + | {{#set: pathway associated=TRPSYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:10, 21 March 2018
Gene Ec-27_004020
- left end position:
- 3503428
- transcription direction:
- POSITIVE
- right end position:
- 3513057
- centisome position:
- 54.317497
- Synonym(s):
- Esi_0000_0449
- Esi0000_0449
- IGPS
Reactions associated
- Reaction: IGPSYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome