Difference between revisions of "CREATINE-P"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-16_000240 == * left end position: ** 225366 * transcription direction: ** NEGATIVE * right end position: ** 234541 * centisome position: ** 4.2221...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] == * smiles: ** C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+] * inchi key: **...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=DRBBFCLWYRJSJZ-UHFFFAOYSA-L |
| − | * | + | * common name: |
| − | ** | + | ** creatine-phosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 209.098 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** N-phosphocreatine |
| − | ** | + | ** neo-ton |
| + | ** phosphorylcreatine | ||
| + | ** phosphocreatine | ||
| + | ** P-creatine | ||
| + | ** creatine-P | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[CREATINE-KINASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 67-07-2 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048563 7048563] |
| − | {{#set: | + | * HMDB : HMDB01511 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02305 C02305] | |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.5408799.html 5408799] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58092 58092] | ||
| + | * METABOLIGHTS : MTBLC58092 | ||
| + | {{#set: smiles=C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+]}} | ||
| + | {{#set: inchi key=InChIKey=DRBBFCLWYRJSJZ-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=creatine-phosphate}} | ||
| + | {{#set: molecular weight=209.098 }} | ||
| + | {{#set: common name=N-phosphocreatine|neo-ton|phosphorylcreatine|phosphocreatine|P-creatine|creatine-P}} | ||
| + | {{#set: reversible reaction associated=CREATINE-KINASE-RXN}} | ||
Latest revision as of 19:44, 21 March 2018
Contents
Metabolite CREATINE-P
- smiles:
- C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+]
- inchi key:
- InChIKey=DRBBFCLWYRJSJZ-UHFFFAOYSA-L
- common name:
- creatine-phosphate
- molecular weight:
- 209.098
- Synonym(s):
- N-phosphocreatine
- neo-ton
- phosphorylcreatine
- phosphocreatine
- P-creatine
- creatine-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 67-07-2
- PUBCHEM:
- HMDB : HMDB01511
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58092
"C(C(=O)[O-])N(C)C(NP(=O)([O-])[O-])=[N+" cannot be used as a page name in this wiki.
