Difference between revisions of "RXN-4210"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4210 RXN-4210] == * direction: ** LEFT-TO-RIGHT * common name: ** Sterol delta-7 reductase * ec...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4210 RXN-4210] ==
−
* smiles:
+
* direction:
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
+
 
* common name:
 
* common name:
−
** 6-oxocampestanol
+
** Sterol delta-7 reductase
−
* molecular weight:
+
* ec number:
−
** 416.686   
+
** [http://enzyme.expasy.org/EC/1.3.1.21 EC-1.3.1.21]
 
* Synonym(s):
 
* Synonym(s):
−
** oxocampestanol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-715]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-4126]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-4127]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 5-dehydroavenasterol[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 isofucosterol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-04_004040]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541]
 +
** '''10''' reactions found over '''36''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200917 25200917]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07487 R07487]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15789 C15789]
+
{{#set: common name=Sterol delta-7 reductase}}
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: ec number=EC-1.3.1.21}}
−
{{#set: inchi key=InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N}}
+
{{#set: gene associated=Ec-04_004040}}
−
{{#set: common name=6-oxocampestanol}}
+
{{#set: in pathway=PWY-2541}}
−
{{#set: molecular weight=416.686    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=oxocampestanol}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: consumed by=RXN-715}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:44, 21 March 2018

Reaction RXN-4210

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Sterol delta-7 reductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 5-dehydroavenasterol[c] + 1 H+[c] + 1 NADPH[c] => 1 NADP+[c] + 1 isofucosterol[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2541, plant sterol biosynthesis: PWY-2541
    • 10 reactions found over 36 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-4210&oldid=29063"