Difference between revisions of "Ec-05 006410"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=SECPZKHBE...") |
(Created page with "Category:Gene == Gene Ec-05_006410 == * left end position: ** 8447672 * transcription direction: ** NEGATIVE * right end position: ** 8454331 * centisome position: ** 92.7...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-05_006410 == |
− | * | + | * left end position: |
− | ** | + | ** 8447672 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 8454331 |
− | * | + | * centisome position: |
− | ** | + | ** 92.79583 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0075_0064 |
− | ** | + | ** Esi0075_0064 |
− | ** | + | ** P5CR |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PYRROLINECARBREDUCT-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN66-546]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: ec-number | |
+ | == Pathways associated == | ||
+ | * [[PROSYN-PWY]] | ||
+ | * [[ARG-PRO-PWY]] | ||
+ | * [[PWY-6344]] | ||
+ | * [[PWY-4981]] | ||
+ | * [[PWY-3341]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=8447672}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=8454331}} | |
− | + | {{#set: centisome position=92.79583 }} | |
− | + | {{#set: common name=Esi_0075_0064|Esi0075_0064|P5CR}} | |
− | + | {{#set: reaction associated=PYRROLINECARBREDUCT-RXN|RXN66-546}} | |
− | + | {{#set: pathway associated=PROSYN-PWY|ARG-PRO-PWY|PWY-6344|PWY-4981|PWY-3341}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:44, 21 March 2018
Gene Ec-05_006410
- left end position:
- 8447672
- transcription direction:
- NEGATIVE
- right end position:
- 8454331
- centisome position:
- 92.79583
- Synonym(s):
- Esi_0075_0064
- Esi0075_0064
- P5CR
Reactions associated
- Reaction: PYRROLINECARBREDUCT-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN66-546
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome