Difference between revisions of "CPD-9245"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=SECPZKHBE...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCC=CCCCCCCCC(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SECPZKHBENQXJG-FPLPWBNLSA-M |
* common name: | * common name: | ||
| − | ** | + | ** palmitoleate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 253.404 |
* Synonym(s): | * Synonym(s): | ||
| + | ** palmitoleic acid (16:1Δ9) | ||
| + | ** palmitoleic acid | ||
| + | ** (9Z)-hexadecenoic acid | ||
| + | ** cis-9-hexadecenoic acid | ||
| + | ** (9Z)-hexadecenoate | ||
| + | ** cis-9-hexadecenoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-7248]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9550[CCO-CYTOSOL]-Palmitoleoyl-ACPs/WATER//CPD-9245/ACP/PROTON.58.]] | ||
| + | * [[RXN-9550]] | ||
| + | * [[RXN-10662]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 373-49-9 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5461012 5461012] |
| − | {{#set: smiles= | + | * HMDB : HMDB03229 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08362 C08362] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: consumed by=RXN- | + | ** [http://www.chemspider.com/Chemical-Structure.4574392.html 4574392] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32372 32372] | ||
| + | * METABOLIGHTS : MTBLC32372 | ||
| + | {{#set: smiles=CCCCCCC=CCCCCCCCC(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=SECPZKHBENQXJG-FPLPWBNLSA-M}} | ||
| + | {{#set: common name=palmitoleate}} | ||
| + | {{#set: molecular weight=253.404 }} | ||
| + | {{#set: common name=palmitoleic acid (16:1Δ9)|palmitoleic acid|(9Z)-hexadecenoic acid|cis-9-hexadecenoic acid|(9Z)-hexadecenoate|cis-9-hexadecenoate}} | ||
| + | {{#set: consumed by=RXN0-7248}} | ||
| + | {{#set: produced by=RXN-9550[CCO-CYTOSOL]-Palmitoleoyl-ACPs/WATER//CPD-9245/ACP/PROTON.58.|RXN-9550|RXN-10662}} | ||
Latest revision as of 19:45, 21 March 2018
Contents
Metabolite CPD-9245
- smiles:
- CCCCCCC=CCCCCCCCC(=O)[O-]
- inchi key:
- InChIKey=SECPZKHBENQXJG-FPLPWBNLSA-M
- common name:
- palmitoleate
- molecular weight:
- 253.404
- Synonym(s):
- palmitoleic acid (16:1Δ9)
- palmitoleic acid
- (9Z)-hexadecenoic acid
- cis-9-hexadecenoic acid
- (9Z)-hexadecenoate
- cis-9-hexadecenoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 373-49-9
- PUBCHEM:
- HMDB : HMDB03229
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC32372
"CCCCCCC=CCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.
"RXN-9550[CCO-CYTOSOL]-Palmitoleoyl-ACPs/WATER//CPD-9245/ACP/PROTON.58." cannot be used as a page name in this wiki.
