Difference between revisions of "CPD-505"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_002600 == * Synonym(s): ** Esi_0198_0021 ** Esi0198_0021 == Reactions associated == * 1TRANSKETO-RXN ** pantograph-aragem ** pan...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] == * smiles: ** C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] == |
| + | * smiles: | ||
| + | ** C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZAWIXNGTTZTBKV-JMVOWJSSSA-F | ||
| + | * common name: | ||
| + | ** D-myo-inositol (1,3,4,6)-tetrakisphosphate | ||
| + | * molecular weight: | ||
| + | ** 492.013 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Ins(1,3,4,6)P4 |
| − | ** | + | ** inositol (1,3,4,6)-tetrakisphosphate |
| + | ** 1D-myo -inositol 1,3,4,6-tetrakisphosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[2.7.1.140-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[2.7.1.133-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04477 C04477] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57660 57660] | ||
| + | * METABOLIGHTS : MTBLC57660 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201336 25201336] | ||
| + | * HMDB : HMDB01187 | ||
| + | {{#set: smiles=C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}} | ||
| + | {{#set: inchi key=InChIKey=ZAWIXNGTTZTBKV-JMVOWJSSSA-F}} | ||
| + | {{#set: common name=D-myo-inositol (1,3,4,6)-tetrakisphosphate}} | ||
| + | {{#set: molecular weight=492.013 }} | ||
| + | {{#set: common name=Ins(1,3,4,6)P4|inositol (1,3,4,6)-tetrakisphosphate|1D-myo -inositol 1,3,4,6-tetrakisphosphate}} | ||
| + | {{#set: consumed by=2.7.1.140-RXN}} | ||
| + | {{#set: produced by=2.7.1.133-RXN}} | ||
Latest revision as of 19:45, 21 March 2018
Contents
Metabolite CPD-505
- smiles:
- C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
- inchi key:
- InChIKey=ZAWIXNGTTZTBKV-JMVOWJSSSA-F
- common name:
- D-myo-inositol (1,3,4,6)-tetrakisphosphate
- molecular weight:
- 492.013
- Synonym(s):
- Ins(1,3,4,6)P4
- inositol (1,3,4,6)-tetrakisphosphate
- 1D-myo -inositol 1,3,4,6-tetrakisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.
