Difference between revisions of "CPD-10794"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2006 RXN-2006] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10794 CPD-10794] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10794 CPD-10794] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC4(C(O)C(O)C(O4)OP(=O)([O-])[O-]))(=O)[O-] |
| + | * inchi key: | ||
| + | ** InChIKey=CUNFRFHBHMFVPH-TYASJMOZSA-J | ||
| + | * common name: | ||
| + | ** ADP ribose 1''-phosphate | ||
| + | * molecular weight: | ||
| + | ** 635.268 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** adenosine diphosphate ribose 1'' phosphate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10034]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12055]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123525 44123525] |
| − | {{#set: | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC4(C(O)C(O)C(O4)OP(=O)([O-])[O-]))(=O)[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=CUNFRFHBHMFVPH-TYASJMOZSA-J}} |
| − | {{#set: | + | {{#set: common name=ADP ribose 1''-phosphate}} |
| − | {{#set: | + | {{#set: molecular weight=635.268 }} |
| − | {{#set: | + | {{#set: common name=adenosine diphosphate ribose 1'' phosphate}} |
| − | {{#set: | + | {{#set: consumed by=RXN-10034}} |
| + | {{#set: produced by=RXN-12055}} | ||
Latest revision as of 19:45, 21 March 2018
Contents
Metabolite CPD-10794
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC4(C(O)C(O)C(O4)OP(=O)([O-])[O-]))(=O)[O-]
- inchi key:
- InChIKey=CUNFRFHBHMFVPH-TYASJMOZSA-J
- common name:
- ADP ribose 1-phosphate
- molecular weight:
- 635.268
- Synonym(s):
- adenosine diphosphate ribose 1 phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC4(C(O)C(O)C(O4)OP(=O)([O-])[O-]))(=O)[O-" cannot be used as a page name in this wiki.
