Difference between revisions of "CPD-13377"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Hex-2-enoyl-ACPs Hex-2-enoyl-ACPs] == * common name: ** a trans hex-2-enoyl-[acp] * Synonym(s):...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Hex-2-enoyl-ACPs Hex-2-enoyl-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] ==
 +
* smiles:
 +
** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
 +
* inchi key:
 +
** InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N
 
* common name:
 
* common name:
** a trans hex-2-enoyl-[acp]
+
** XLXG xyloglucan oligosaccharide
 +
* molecular weight:
 +
** 1225.073   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9658]]
+
* [[RXN-12399]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a trans hex-2-enoyl-[acp]}}
+
* PUBCHEM:
{{#set: consumed by=RXN-9658}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940192 52940192]
 +
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
 +
{{#set: inchi key=InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N}}
 +
{{#set: common name=XLXG xyloglucan oligosaccharide}}
 +
{{#set: molecular weight=1225.073    }}
 +
{{#set: consumed by=RXN-12399}}

Latest revision as of 19:45, 21 March 2018

Metabolite CPD-13377

  • smiles:
    • C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
  • inchi key:
    • InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N
  • common name:
    • XLXG xyloglucan oligosaccharide
  • molecular weight:
    • 1225.073
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links