Difference between revisions of "CPD-16618"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12647 RXN-12647] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * inchi key: ** InChIKey=QWHDXIUUXW...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12647 RXN-12647] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(C(=O)[O-])C(O)[CH]=O
 +
* inchi key:
 +
** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
 +
* common name:
 +
** L-malic semialdehyde
 +
* molecular weight:
 +
** 117.081   
 
* Synonym(s):
 
* Synonym(s):
 +
** (3R)-3-hydroxy-4-oxobutanoate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-6002]]
** 1 [[Oxidized-Plastocyanins]][c] '''+''' 1 [[E-]][c] '''=>''' 1 [[Plastocyanin-Reduced]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
**
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=L-malic semialdehyde}}
 +
{{#set: molecular weight=117.081    }}
 +
{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
 +
{{#set: consumed by=RXN-6002}}

Latest revision as of 20:45, 21 March 2018

Metabolite CPD-16618

  • smiles:
    • C(C(=O)[O-])C(O)[CH]=O
  • inchi key:
    • InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
  • common name:
    • L-malic semialdehyde
  • molecular weight:
    • 117.081
  • Synonym(s):
    • (3R)-3-hydroxy-4-oxobutanoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(=O)[O-])C(O)[CH]=O" cannot be used as a page name in this wiki.