Difference between revisions of "Charged-CYS-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == * smiles: ** CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-CYS-tRNAs Charged-CYS-tRNAs] == * common name: ** an L-cysteinyl-[tRNAcys] * Synonym(s)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-CYS-tRNAs Charged-CYS-tRNAs] ==
* smiles:
+
** CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J
+
 
* common name:
 
* common name:
** trans-Δ2, cis-Δ4-decadienoyl-CoA
+
** an L-cysteinyl-[tRNAcys]
* molecular weight:
+
** 913.722   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** L-CYSTEINYL-TRNA(CYS)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIENOYLCOAREDUCT-RXN]]
+
* [[RXN-16637]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CYSTEINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an L-cysteinyl-[tRNAcys]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658212 90658212]
+
{{#set: common name=L-CYSTEINYL-TRNA(CYS)}}
{{#set: smiles=CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: consumed by=RXN-16637}}
{{#set: inchi key=InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J}}
+
{{#set: produced by=CYSTEINE--TRNA-LIGASE-RXN}}
{{#set: common name=trans-Δ2, cis-Δ4-decadienoyl-CoA}}
+
{{#set: molecular weight=913.722    }}
+
{{#set: consumed by=DIENOYLCOAREDUCT-RXN}}
+

Latest revision as of 19:45, 21 March 2018

Metabolite Charged-CYS-tRNAs

  • common name:
    • an L-cysteinyl-[tRNAcys]
  • Synonym(s):
    • L-CYSTEINYL-TRNA(CYS)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-cysteinyl-[tRNAcys" cannot be used as a page name in this wiki.