Difference between revisions of "RXN3O-4157"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13695 CPD-13695] == * smiles: ** CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-4157 RXN3O-4157] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13695 CPD-13695] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-4157 RXN3O-4157] ==
* smiles:
+
* direction:
** CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
+
** REVERSIBLE
* inchi key:
+
* ec number:
** InChIKey=ZVFUUGBGZMBUAN-KZNRQMKSSA-J
+
** [http://enzyme.expasy.org/EC/2.6.1.58 EC-2.6.1.58]
* common name:
+
** 3,24-dioxocholest-4-en-26-oyl-CoA
+
* molecular weight:
+
** 1174.098   
+
 
* Synonym(s):
 
* Synonym(s):
** cholest-4-en--3,24,dione-26-oyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12705]]
+
** 1 [[TYR]][c] '''+''' 1 [[PYRUVATE]][c] '''<=>''' 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[P-HYDROXY-PHENYLPYRUVATE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-tyrosine[c] '''+''' 1 pyruvate[c] '''<=>''' 1 L-alanine[c] '''+''' 1 4-hydroxyphenylpyruvate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY3O-4108]], L-tyrosine degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-4108 PWY3O-4108]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659292 90659292]
+
** [http://www.genome.jp/dbget-bin/www_bget?R09254 R09254]
{{#set: smiles=CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}}
+
{{#set: direction=REVERSIBLE}}
{{#set: inchi key=InChIKey=ZVFUUGBGZMBUAN-KZNRQMKSSA-J}}
+
{{#set: ec number=EC-2.6.1.58}}
{{#set: common name=3,24-dioxocholest-4-en-26-oyl-CoA}}
+
{{#set: in pathway=PWY3O-4108}}
{{#set: molecular weight=1174.098    }}
+
{{#set: reconstruction category=gap-filling}}
{{#set: common name=cholest-4-en--3,24,dione-26-oyl-CoA}}
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
{{#set: produced by=RXN-12705}}
+
{{#set: reconstruction tool=meneco}}
 +
{{#set: reconstruction comment=added for gapfilling}}

Latest revision as of 19:45, 21 March 2018

Reaction RXN3O-4157

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY3O-4108, L-tyrosine degradation III: PWY3O-4108
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links