Difference between revisions of "Histone-Acetyl-Lysine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROSIROHYDROCHLORIN DIHYDROSIROHYDROCHLORIN] == * smiles: ** CC5(CC(=O)[O-])(C(C4(=CC1(NC(=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-Acetyl-Lysine Histone-Acetyl-Lysine] == * common name: ** a [histone]-N6-acetyl-L-lysin...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROSIROHYDROCHLORIN DIHYDROSIROHYDROCHLORIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-Acetyl-Lysine Histone-Acetyl-Lysine] ==
−
* smiles:
+
−
** CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-])
+
−
* inchi key:
+
−
** InChIKey=OQIIYZQTTMKFAU-ZNLOQLQNSA-G
+
 
* common name:
 
* common name:
−
** precorrin-2
+
** a [histone]-N6-acetyl-L-lysine
−
* molecular weight:
+
−
** 857.803   
+
 
* Synonym(s):
 
* Synonym(s):
−
** dihydrosirohydrochlorin
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-13403]]
 
−
* [[RXN-8675]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-8759]]
+
* [[3.5.1.98-RXN]]
 +
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
−
* CAS : 82542-92-5
+
{{#set: common name=a [histone]-N6-acetyl-L-lysine}}
−
* PUBCHEM:
+
{{#set: reversible reaction associated=3.5.1.98-RXN|HISTONE-ACETYLTRANSFERASE-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245987 25245987]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58827 58827]
+
−
* BIGG : 39875
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02463 C02463]
+
−
{{#set: smiles=CC5(CC(=O)[O-])(C(C4(=CC1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CCC(=O)[O-])C(CC(=O)[O-])=C(N2)C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(=N3)C=C([N+]4)5)))))CCC(=O)[O-])}}
+
−
{{#set: inchi key=InChIKey=OQIIYZQTTMKFAU-ZNLOQLQNSA-G}}
+
−
{{#set: common name=precorrin-2}}
+
−
{{#set: molecular weight=857.803    }}
+
−
{{#set: common name=dihydrosirohydrochlorin}}
+
−
{{#set: produced by=RXN-13403|RXN-8675}}
+
−
{{#set: reversible reaction associated=RXN-8759}}
+

Latest revision as of 19:46, 21 March 2018

Metabolite Histone-Acetyl-Lysine

  • common name:
    • a [histone]-N6-acetyl-L-lysine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [histone]-N6-acetyl-L-lysine" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Histone-Acetyl-Lysine&oldid=29166"