Difference between revisions of "Ec-09 002410"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == * smiles: ** CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CC...")
(Created page with "Category:Gene == Gene Ec-09_002410 == * Synonym(s): ** Esi_0337_0029 ** Esi0337_0029 == Reactions associated == * Reaction: DIAMINOPIMDECARB-RXN ** Source: ortholog...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] ==
+
== Gene Ec-09_002410 ==
* smiles:
+
** CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))
+
* inchi key:
+
** InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M
+
* common name:
+
** epoxypheophorbide a
+
* molecular weight:
+
** 606.677   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0337_0029
 +
** Esi0337_0029
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17253]]
+
* Reaction: [[DIAMINOPIMDECARB-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
* [[RXN-17252]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[PWY-5097]]
 +
* [[PWY-2942]]
 +
* [[DAPLYSINESYN-PWY]]
 +
* [[PWY-2941]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCC1(=C(C)C3(=NC1=CC6(=C(C)C7(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)C=C5(C(C)=C(C=C)C4(OC34)(N5))))C(N6)=7))))}}
+
{{#set: common name=Esi_0337_0029|Esi0337_0029}}
{{#set: inchi key=InChIKey=ZMTPZDVBGYNPLZ-YGOWEZGDSA-M}}
+
{{#set: reaction associated=DIAMINOPIMDECARB-RXN}}
{{#set: common name=epoxypheophorbide a}}
+
{{#set: pathway associated=PWY-5097|PWY-2942|DAPLYSINESYN-PWY|PWY-2941}}
{{#set: molecular weight=606.677    }}
+
{{#set: consumed by=RXN-17253}}
+
{{#set: produced by=RXN-17252}}
+

Latest revision as of 19:46, 21 March 2018

Gene Ec-09_002410

  • Synonym(s):
    • Esi_0337_0029
    • Esi0337_0029

Reactions associated

Pathways associated

External links