Difference between revisions of "Ec-13 002160"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8117 CPD-8117] == * smiles: ** CCCCCC=CCC=CCC=CCCCCC(=O)[O-] * inchi key: ** InChIKey=VZCCE...") |
(Created page with "Category:Gene == Gene Ec-13_002160 == * left end position: ** 3778053 * transcription direction: ** NEGATIVE * right end position: ** 3793194 * centisome position: ** 54.4...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-13_002160 == |
− | * | + | * left end position: |
− | ** | + | ** 3778053 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3793194 |
− | * | + | * centisome position: |
− | ** | + | ** 54.4681 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0427_0005 |
− | ** | + | ** Esi0427_0005 |
− | ** | + | ** TS |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-14125]] | |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | == | + | * Reaction: [[THRESYN-RXN]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[HOMOSER-THRESYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3778053}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3793194}} | |
− | + | {{#set: centisome position=54.4681 }} | |
− | + | {{#set: common name=Esi_0427_0005|Esi0427_0005|TS}} | |
− | + | {{#set: reaction associated=RXN-14125|THRESYN-RXN}} | |
− | + | {{#set: pathway associated=HOMOSER-THRESYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:46, 21 March 2018
Gene Ec-13_002160
- left end position:
- 3778053
- transcription direction:
- NEGATIVE
- right end position:
- 3793194
- centisome position:
- 54.4681
- Synonym(s):
- Esi_0427_0005
- Esi0427_0005
- TS
Reactions associated
- Reaction: RXN-14125
- Source: orthology-aragem
- Reaction: THRESYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome