Difference between revisions of "CPD-11241"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-04_001040 == * left end position: ** 1153606 * transcription direction: ** NEGATIVE * right end position: ** 1164771 * centisome position: ** 17.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] == * smiles: ** C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=LLVVMXFNKAHVEZ-GAWNPARCSA-L |
| − | * | + | * common name: |
| − | ** | + | ** 4-(4-deoxy-α-D-galact-4-enuronosyl)-D-galacturonate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 350.235 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4-(4-deoxy-β-D-gluc-4-enuronosyl)-D-galacturonate |
| − | ** | + | ** 4-(4-deoxy-β-D-gluc-4-enuronosyl)-galacturonate |
| + | ** 4-(4-deoxy-α-D-gluc-4-enuronosyl)-D-galacturonate | ||
| + | ** unsaturated digalacturonate | ||
| + | ** 4-(4-deoxy-α-D-gluc-4-enosyluronic acid)-D-galacturonic acid | ||
| + | ** 4-O-(4-deoxy-β-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-14897]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878600 46878600] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60189 60189] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04733 C04733] | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06118 C06118] |
| + | {{#set: smiles=C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O))}} | ||
| + | {{#set: inchi key=InChIKey=LLVVMXFNKAHVEZ-GAWNPARCSA-L}} | ||
| + | {{#set: common name=4-(4-deoxy-α-D-galact-4-enuronosyl)-D-galacturonate}} | ||
| + | {{#set: molecular weight=350.235 }} | ||
| + | {{#set: common name=4-(4-deoxy-β-D-gluc-4-enuronosyl)-D-galacturonate|4-(4-deoxy-β-D-gluc-4-enuronosyl)-galacturonate|4-(4-deoxy-α-D-gluc-4-enuronosyl)-D-galacturonate|unsaturated digalacturonate|4-(4-deoxy-α-D-gluc-4-enosyluronic acid)-D-galacturonic acid|4-O-(4-deoxy-β-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid}} | ||
| + | {{#set: produced by=RXN-14897}} | ||
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite CPD-11241
- smiles:
- C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O))
- inchi key:
- InChIKey=LLVVMXFNKAHVEZ-GAWNPARCSA-L
- common name:
- 4-(4-deoxy-α-D-galact-4-enuronosyl)-D-galacturonate
- molecular weight:
- 350.235
- Synonym(s):
- 4-(4-deoxy-β-D-gluc-4-enuronosyl)-D-galacturonate
- 4-(4-deoxy-β-D-gluc-4-enuronosyl)-galacturonate
- 4-(4-deoxy-α-D-gluc-4-enuronosyl)-D-galacturonate
- unsaturated digalacturonate
- 4-(4-deoxy-α-D-gluc-4-enosyluronic acid)-D-galacturonic acid
- 4-O-(4-deoxy-β-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O))" cannot be used as a page name in this wiki.
