Difference between revisions of "Ec-28 000050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] == * smiles: ** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1) * inchi key: ** InChIKe...")
(Created page with "Category:Gene == Gene Ec-28_000050 == * left end position: ** 25359 * transcription direction: ** NEGATIVE * right end position: ** 29609 * centisome position: ** 0.669276...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] ==
+
== Gene Ec-28_000050 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)
+
** 25359
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** linamarin
+
** 29609
−
* molecular weight:
+
* centisome position:
−
** 247.247    
+
** 0.669276    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile
+
** Esi_0120_0005
−
** 1-cyano-1-methylethyl beta-D-glucoside
+
** Esi0120_0005
 +
** MPI4
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-5341]]
+
* Reaction: [[MANNPISOM-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-13602]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[MANNCAT-PWY]]
 +
* [[PWY-882]]
 +
* [[PWY-7456]]
 +
* [[PWY-3881]]
 +
* [[PWY-5659]]
 +
* [[PWY-6992]]
 +
* [[PWY-3861]]
 +
* [[PWY-7586]]
 
== External links  ==
 
== External links  ==
−
* CAS : 554-35-8
+
{{#set: left end position=25359}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11128 11128]
+
{{#set: right end position=29609}}
−
* HMDB : HMDB33699
+
{{#set: centisome position=0.669276   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0120_0005|Esi0120_0005|MPI4}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01594 C01594]
+
{{#set: reaction associated=MANNPISOM-RXN}}
−
* CHEMSPIDER:
+
{{#set: pathway associated=MANNCAT-PWY|PWY-882|PWY-7456|PWY-3881|PWY-5659|PWY-6992|PWY-3861|PWY-7586}}
−
** [http://www.chemspider.com/Chemical-Structure.10657.html 10657]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16441 16441]
+
−
{{#set: smiles=CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N}}
+
−
{{#set: common name=linamarin}}
+
−
{{#set: molecular weight=247.247   }}
+
−
{{#set: common name=2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile|1-cyano-1-methylethyl beta-D-glucoside}}
+
−
{{#set: consumed by=RXN-5341}}
+
−
{{#set: produced by=RXN-13602}}
+

Latest revision as of 19:47, 21 March 2018

Gene Ec-28_000050

  • left end position:
    • 25359
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 29609
  • centisome position:
    • 0.669276
  • Synonym(s):
    • Esi_0120_0005
    • Esi0120_0005
    • MPI4

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-28_000050&oldid=29267"