Difference between revisions of "CPD-19144"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-IDITOL-2-DEHYDROGENASE-RXN L-IDITOL-2-DEHYDROGENASE-RXN] == * direction: ** REVERSIBLE * common n...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-IDITOL-2-DEHYDROGENASE-RXN L-IDITOL-2-DEHYDROGENASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
 
* common name:
 
* common name:
−
** GroES (chaperonin 10)-like
+
** (7Z)-hexadecenoyl-CoA
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.14 EC-1.1.1.14]
+
** 999.899   
 
* Synonym(s):
 
* Synonym(s):
 +
** cis-hexadec-7-enoyl-CoA
 +
** (7Z)-hexadec-7-enoyl-CoA
 +
** 16:1 cis-7
 +
** 16:1(n-9)
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17779]]
−
** 1 [[NAD]][c] '''+''' 1 [[CPD-369]][c] '''<=>''' 1 [[CPD-15616]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD+[c] '''+''' 1 L-iditol[c] '''<=>''' 1 keto-L-sorbose[c] '''+''' 1 NADH[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-18_002860]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10160 10160]
+
{{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}}
−
* LIGAND-RXN:
+
{{#set: common name=(7Z)-hexadecenoyl-CoA}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R07145 R07145]
+
{{#set: molecular weight=999.899    }}
−
* UNIPROT:
+
{{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}}
−
** [http://www.uniprot.org/uniprot/Q06004 Q06004]
+
{{#set: consumed by=RXN-17779}}
−
** [http://www.uniprot.org/uniprot/Q00796 Q00796]
+
−
** [http://www.uniprot.org/uniprot/Q57517 Q57517]
+
−
** [http://www.uniprot.org/uniprot/P77280 P77280]
+
−
** [http://www.uniprot.org/uniprot/O35045 O35045]
+
−
** [http://www.uniprot.org/uniprot/P27867 P27867]
+
−
** [http://www.uniprot.org/uniprot/Q02912 Q02912]
+
−
** [http://www.uniprot.org/uniprot/P36624 P36624]
+
−
** [http://www.uniprot.org/uniprot/P35497 P35497]
+
−
** [http://www.uniprot.org/uniprot/Q64442 Q64442]
+
−
** [http://www.uniprot.org/uniprot/Q07786 Q07786]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=GroES (chaperonin 10)-like}}
+
−
{{#set: ec number=EC-1.1.1.14}}
+
−
{{#set: gene associated=Ec-18_002860}}
+
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:47, 21 March 2018

Metabolite CPD-19144

  • smiles:
    • CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
  • common name:
    • (7Z)-hexadecenoyl-CoA
  • molecular weight:
    • 999.899
  • Synonym(s):
    • cis-hexadec-7-enoyl-CoA
    • (7Z)-hexadec-7-enoyl-CoA
    • 16:1 cis-7
    • 16:1(n-9)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-19144&oldid=29278"