Difference between revisions of "Ec-12 006450"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] == * smiles: ** C([O-])(=O)C([N+])CC1(C=CC=CC=1) * inchi key: ** InChIKey=COLNVLDHVKWL...") |
(Created page with "Category:Gene == Gene Ec-12_006450 == * left end position: ** 5765397 * transcription direction: ** NEGATIVE * right end position: ** 5782210 * centisome position: ** 69.1...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_006450 == |
− | * | + | * left end position: |
− | ** | + | ** 5765397 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5782210 |
− | * | + | * centisome position: |
− | ** | + | ** 69.1622 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0115_0051 |
− | ** | + | ** Esi0115_0051 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: go-term | |
− | + | == Pathways associated == | |
− | + | ||
− | * [[ | + | |
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5765397}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5782210}} | |
− | + | {{#set: centisome position=69.1622 }} | |
− | + | {{#set: common name=Esi_0115_0051|Esi0115_0051}} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:47, 21 March 2018
Gene Ec-12_006450
- left end position:
- 5765397
- transcription direction:
- NEGATIVE
- right end position:
- 5782210
- centisome position:
- 69.1622
- Synonym(s):
- Esi_0115_0051
- Esi0115_0051
Reactions associated
- Reaction: DNA-DIRECTED-RNA-POLYMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome