Difference between revisions of "RXN-969"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-PROPIONYL-COA 3-HYDROXY-PROPIONYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-969 RXN-969] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycolate Oxidase ** Alpha-hydr...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-PROPIONYL-COA 3-HYDROXY-PROPIONYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-969 RXN-969] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BERBFZCUSMQABM-IEXPHMLFSA-J
+
 
* common name:
 
* common name:
−
** 3-hydroxypropanoyl-CoA
+
** Glycolate Oxidase
−
* molecular weight:
+
** Alpha-hydroxy acid dehydrogenase, FMN-dependent
−
** 835.566   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.3.15 EC-1.1.3.15]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxypropionyl-coenzyme A
 
−
** 3-hydroxypropionyl-CoA
 
−
** 3-hydroxypropanoyl coenzymeA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[GLYCOLLATE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[GLYOX]][c]
−
* [[RXN-6383]]
+
* With common name(s):
 +
** 1 oxygen[c] '''+''' 1 glycolate[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 glyoxylate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-12_004150]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-23_000460]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-15_000450]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-181]], photorespiration: [http://metacyc.org/META/NEW-IMAGE?object=PWY-181 PWY-181]
 +
** '''6''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C05668 C05668]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25311 25311]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58528 58528]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00475 R00475]
−
* METABOLIGHTS : MTBLC58528
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Glycolate Oxidase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229175 44229175]
+
{{#set: common name=Alpha-hydroxy acid dehydrogenase, FMN-dependent}}
−
* HMDB : HMDB06807
+
{{#set: ec number=EC-1.1.3.15}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: gene associated=Ec-12_004150|Ec-23_000460|Ec-15_000450}}
−
{{#set: inchi key=InChIKey=BERBFZCUSMQABM-IEXPHMLFSA-J}}
+
{{#set: in pathway=PWY-181}}
−
{{#set: common name=3-hydroxypropanoyl-CoA}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: molecular weight=835.566    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: common name=3-hydroxypropionyl-coenzyme A|3-hydroxypropionyl-CoA|3-hydroxypropanoyl coenzymeA}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: reversible reaction associated=RXN-6383}}
+

Latest revision as of 19:47, 21 March 2018

Reaction RXN-969

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glycolate Oxidase
    • Alpha-hydroxy acid dehydrogenase, FMN-dependent
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-181, photorespiration: PWY-181
    • 6 reactions found over 9 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-969&oldid=29298"