Difference between revisions of "Ec-05 002890"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9...")
(Created page with "Category:Gene == Gene Ec-05_002890 == * left end position: ** 4568711 * transcription direction: ** NEGATIVE * right end position: ** 4573301 * centisome position: ** 50.1...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] ==
+
== Gene Ec-05_002890 ==
−
* smiles:
+
* left end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 4568711
−
* common name:
+
* transcription direction:
−
** 3,8-divinyl protochlorophyllide a
+
** NEGATIVE
−
* molecular weight:
+
* right end position:
−
** 608.935    
+
** 4573301
 +
* centisome position:
 +
** 50.186287    
 
* Synonym(s):
 
* Synonym(s):
−
** divinylprotochlorophyllide
+
** Esi_0004_0227
 +
** Esi0004_0227
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-5285]]
+
* Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4568711}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743931 54743931]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4573301}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632]
+
{{#set: centisome position=50.186287   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0004_0227|Esi0004_0227}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831]
+
{{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=3,8-divinyl protochlorophyllide a}}
+
−
{{#set: molecular weight=608.935   }}
+
−
{{#set: common name=divinylprotochlorophyllide}}
+
−
{{#set: consumed by=RXN-5285}}
+

Latest revision as of 19:47, 21 March 2018

Gene Ec-05_002890

  • left end position:
    • 4568711
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4573301
  • centisome position:
    • 50.186287
  • Synonym(s):
    • Esi_0004_0227
    • Esi0004_0227

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_002890&oldid=29304"