Difference between revisions of "RXN-10949"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8123 CPD-8123] == * smiles: ** C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10949 RXN-10949] == * direction: ** LEFT-TO-RIGHT * common name: ** Inositol monophosphatase *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8123 CPD-8123] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10949 RXN-10949] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J
+
 
* common name:
 
* common name:
−
** MoO2-molybdopterin cofactor
+
** Inositol monophosphatase
−
* molecular weight:
+
* ec number:
−
** 519.251   
+
** [http://enzyme.expasy.org/EC/3.1.3.25 EC-3.1.3.25]
 
* Synonym(s):
 
* Synonym(s):
−
** MoCo (dioxyo)
 
−
** molybdenum cofactor (dioxyo)
 
−
** MoO2(OH)Dtpp-mP
 
−
** {[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate
 
−
** MoO2-Mo-MPT
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-8348]]
+
** 1 [[WATER]][c] '''+''' 1 [[Myo-inositol-monophosphates]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[MYO-INOSITOL]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 a myo-inositol monophosphate[c] '''=>''' 1 phosphate[c] '''+''' 1 myo-inositol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-02_005670]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70680283 70680283]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07343 R07343]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71302 71302]
+
{{#set: common name=Inositol monophosphatase}}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))}}
+
{{#set: ec number=EC-3.1.3.25}}
−
{{#set: inchi key=InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J}}
+
{{#set: gene associated=Ec-02_005670}}
−
{{#set: common name=MoO2-molybdopterin cofactor}}
+
{{#set: in pathway=}}
−
{{#set: molecular weight=519.251    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=MoCo (dioxyo)|molybdenum cofactor (dioxyo)|MoO2(OH)Dtpp-mP|{[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate|MoO2-Mo-MPT}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: produced by=RXN-8348}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:10, 21 March 2018

Reaction RXN-10949

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Inositol monophosphatase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10949&oldid=25058"