Difference between revisions of "Ec-06 001090"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-BETA-ASPARTYL-P L-BETA-ASPARTYL-P] == * smiles: ** C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-] *...") |
(Created page with "Category:Gene == Gene Ec-06_001090 == * left end position: ** 727586 * transcription direction: ** POSITIVE * right end position: ** 734509 * centisome position: ** 8.3079...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_001090 == |
− | * | + | * left end position: |
− | ** | + | ** 727586 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 734509 |
− | * | + | * centisome position: |
− | ** | + | ** 8.307902 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0279_0022 |
− | ** | + | ** Esi0279_0022 |
− | ** | + | ** IPS |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN66-579]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-2301]] | ||
+ | * [[PWY-4661]] | ||
+ | * [[PWY-6580]] | ||
+ | * [[PWY-6664]] | ||
+ | * [[PWY1G-0]] | ||
+ | * [[PWY-6372]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=727586}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=734509}} | |
− | + | {{#set: centisome position=8.307902 }} | |
− | + | {{#set: common name=Esi_0279_0022|Esi0279_0022|IPS}} | |
− | + | {{#set: reaction associated=MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN|RXN66-579}} | |
− | + | {{#set: pathway associated=PWY-2301|PWY-4661|PWY-6580|PWY-6664|PWY1G-0|PWY-6372}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:47, 21 March 2018
Gene Ec-06_001090
- left end position:
- 727586
- transcription direction:
- POSITIVE
- right end position:
- 734509
- centisome position:
- 8.307902
- Synonym(s):
- Esi_0279_0022
- Esi0279_0022
- IPS
Reactions associated
- Reaction: MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN66-579
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome