Difference between revisions of "DIVINYL-PROTOCHLOROPHYLLIDE-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-13_002010 == * Synonym(s): ** Esi_0439_0001 ** Esi0439_0001 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-13_002010 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] ==
 +
* smiles:
 +
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
 +
* common name:
 +
** 3,8-divinyl protochlorophyllide a
 +
* molecular weight:
 +
** 608.935   
 
* Synonym(s):
 
* Synonym(s):
** Esi_0439_0001
+
** divinylprotochlorophyllide
** Esi0439_0001
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-8443]]
+
* [[RXN-5285]]
** [[pantograph]]-[[aragem]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-5381]]
+
 
== External links  ==
 
== External links  ==
{{#set: common name=Esi_0439_0001|Esi0439_0001}}
+
* PUBCHEM:
{{#set: reaction associated=RXN-8443}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743931 54743931]
{{#set: pathway associated=PWY-5381}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831]
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: common name=3,8-divinyl protochlorophyllide a}}
 +
{{#set: molecular weight=608.935    }}
 +
{{#set: common name=divinylprotochlorophyllide}}
 +
{{#set: consumed by=RXN-5285}}

Latest revision as of 19:47, 21 March 2018

Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • 3,8-divinyl protochlorophyllide a
  • molecular weight:
    • 608.935
  • Synonym(s):
    • divinylprotochlorophyllide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.