Difference between revisions of "CPD-1083"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-12_004890 == * left end position: ** 4510169 * transcription direction: ** POSITIVE * right end position: ** 4512566 * centisome position: ** 54.1...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] == * smiles: ** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-12_004890 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] ==
* left end position:
+
* smiles:
** 4510169
+
** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J
* right end position:
+
* common name:
** 4512566
+
** (E)-2-methylcrotonoyl-CoA
* centisome position:
+
* molecular weight:
** 54.104378    
+
** 845.604    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0070_0013
+
** methylcrotonyl-CoA
** Esi0070_0013
+
** trans-2-methylbut-2-enoyl-CoA
** UROS
+
** 2-methylbut-2-enoyl-CoA
 +
** tigloyl-CoA
 +
** tiglyl-CoA
 +
** 2-methyl-crotonyl-CoA
 +
** (E)-2-methylbut-2-enoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[UROGENIIISYN-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
== Reaction(s) of unknown directionality ==
***ec-number
+
* [[TIGLYLCOA-HYDROXY-RXN]]
== Pathways associated ==
+
* [[RXN-14266]]
* [[PWY-5189]]
+
* [[2-METHYLACYL-COA-DEHYDROGENASE-RXN]]
* [[PWY-5188]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=4510169}}
+
* CAS : 6247-62-7
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
{{#set: right end position=4512566}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266534 45266534]
{{#set: centisome position=54.104378   }}
+
* CHEBI:
{{#set: common name=Esi_0070_0013|Esi0070_0013|UROS}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15478 15478]
{{#set: reaction associated=UROGENIIISYN-RXN}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-5189|PWY-5188}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03345 C03345]
 +
* HMDB : HMDB02054
 +
{{#set: smiles=CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J}}
 +
{{#set: common name=(E)-2-methylcrotonoyl-CoA}}
 +
{{#set: molecular weight=845.604   }}
 +
{{#set: common name=methylcrotonyl-CoA|trans-2-methylbut-2-enoyl-CoA|2-methylbut-2-enoyl-CoA|tigloyl-CoA|tiglyl-CoA|2-methyl-crotonyl-CoA|(E)-2-methylbut-2-enoyl-CoA}}
 +
{{#set: reversible reaction associated=TIGLYLCOA-HYDROXY-RXN|RXN-14266|2-METHYLACYL-COA-DEHYDROGENASE-RXN}}

Latest revision as of 19:47, 21 March 2018

Metabolite CPD-1083

  • smiles:
    • CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J
  • common name:
    • (E)-2-methylcrotonoyl-CoA
  • molecular weight:
    • 845.604
  • Synonym(s):
    • methylcrotonyl-CoA
    • trans-2-methylbut-2-enoyl-CoA
    • 2-methylbut-2-enoyl-CoA
    • tigloyl-CoA
    • tiglyl-CoA
    • 2-methyl-crotonyl-CoA
    • (E)-2-methylbut-2-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.