Difference between revisions of "CPD-10488"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Propionyl-CoA-CO2-ligases Propionyl-CoA-CO2-ligases] == * common name: ** [propionyl-CoA:carbon...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == * smiles: ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) * inchi key: *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == |
+ | * smiles: | ||
+ | ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** N-formyl-D-kynurenine |
+ | * molecular weight: | ||
+ | ** 236.227 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-8664]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245041 25245041] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=55476 55476] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15605 C15605] | ||
+ | * HMDB : HMDB01200 | ||
+ | {{#set: smiles=C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)}} | ||
+ | {{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=N-formyl-D-kynurenine}} | ||
+ | {{#set: molecular weight=236.227 }} | ||
+ | {{#set: produced by=RXN-8664}} |
Latest revision as of 20:47, 21 March 2018
Contents
Metabolite CPD-10488
- smiles:
- C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)
- inchi key:
- InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N
- common name:
- N-formyl-D-kynurenine
- molecular weight:
- 236.227
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)" cannot be used as a page name in this wiki.