Difference between revisions of "CPD-10488"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Propionyl-CoA-CO2-ligases Propionyl-CoA-CO2-ligases] == * common name: ** [propionyl-CoA:carbon...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == * smiles: ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) * inchi key: *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Propionyl-CoA-CO2-ligases Propionyl-CoA-CO2-ligases] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] ==
 +
* smiles:
 +
** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)
 +
* inchi key:
 +
** InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N
 
* common name:
 
* common name:
** [propionyl-CoA:carbon-dioxide ligase (ADP-forming)]
+
** N-formyl-D-kynurenine
 +
* molecular weight:
 +
** 236.227   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6.3.4.10-RXN]]
+
* [[RXN-8664]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=[propionyl-CoA:carbon-dioxide ligase (ADP-forming)]}}
+
* PUBCHEM:
{{#set: produced by=6.3.4.10-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245041 25245041]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=55476 55476]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15605 C15605]
 +
* HMDB : HMDB01200
 +
{{#set: smiles=C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)}}
 +
{{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N}}
 +
{{#set: common name=N-formyl-D-kynurenine}}
 +
{{#set: molecular weight=236.227    }}
 +
{{#set: produced by=RXN-8664}}

Latest revision as of 19:47, 21 March 2018

Metabolite CPD-10488

  • smiles:
    • C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)
  • inchi key:
    • InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N
  • common name:
    • N-formyl-D-kynurenine
  • molecular weight:
    • 236.227
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)" cannot be used as a page name in this wiki.