Difference between revisions of "RXN-9558"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLMETHIONINE N-FORMYLMETHIONINE] == * smiles: ** CSCCC(N[CH]=O)C(=O)[O-] * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9558 RXN-9558] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucose/ribitol dehydrogenase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLMETHIONINE N-FORMYLMETHIONINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9558 RXN-9558] ==
* smiles:
+
* direction:
** CSCCC(N[CH]=O)C(=O)[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=PYUSHNKNPOHWEZ-YFKPBYRVSA-M
+
 
* common name:
 
* common name:
** N-formyl-L-methionine
+
** Glucose/ribitol dehydrogenase
* molecular weight:
+
* ec number:
** 176.21   
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
** fMet
 
** N-formyl-methionine
 
** formylmethionine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[FORMYLMETHIONINE-DEFORMYLASE-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[cis-vaccen-2-enoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[Cis-vaccenoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 a (2-trans-11-cis)-vaccen-2-enoyl-[acp][c] '''+''' 1 NADH[c] '''=>''' 1 a cis-vaccenoyl-[acp][c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_002470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5973]], cis-vaccenate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 4289-98-9
+
{{#set: direction=LEFT-TO-RIGHT}}
* DRUGBANK : DB04464
+
{{#set: common name=Glucose/ribitol dehydrogenase}}
* PUBCHEM:
+
{{#set: ec number=EC-1.3.1.9}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288223 5288223]
+
{{#set: gene associated=Ec-27_002470}}
* HMDB : HMDB01015
+
{{#set: in pathway=PWY-5973}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C03145 C03145]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57809 57809]
+
{{#set: smiles=CSCCC(N[CH]=O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=PYUSHNKNPOHWEZ-YFKPBYRVSA-M}}
+
{{#set: common name=N-formyl-L-methionine}}
+
{{#set: molecular weight=176.21    }}
+
{{#set: common name=fMet|N-formyl-methionine|formylmethionine}}
+
{{#set: consumed by=FORMYLMETHIONINE-DEFORMYLASE-RXN}}
+

Latest revision as of 20:48, 21 March 2018

Reaction RXN-9558

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glucose/ribitol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5973, cis-vaccenate biosynthesis: PWY-5973
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links