Difference between revisions of "CPD-16475"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_004310 == * left end position: ** 3585203 * transcription direction: ** NEGATIVE * right end position: ** 3589358 * centisome position: ** 40.9...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16475 CPD-16475] == * smiles: ** CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-06_004310 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16475 CPD-16475] ==
−
* left end position:
+
* smiles:
−
** 3585203
+
** CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)C(O)C(O)1))2))O3)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=HBBOZFUQJDYASD-QGTNPELVSA-N
−
* right end position:
+
* common name:
−
** 3589358
+
** β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine
−
* centisome position:
+
* molecular weight:
−
** 40.937454    
+
** 529.494    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0062_0090
+
** β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine
−
** Esi0062_0090
+
** Lewis x epitope
 +
** Lex epitope
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ATPASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** [[pantograph]]-[[aragem]]
+
== Reaction(s) of unknown directionality ==
−
* [[ATPSYN-RXN]]
+
* [[RXN-15268]]
−
** esiliculosus_genome
+
−
***go-term
+
−
== Pathways associated ==
+
−
* [[PWY-7219]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3585203}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11813424 11813424]
−
{{#set: right end position=3589358}}
+
* CHEBI:
−
{{#set: centisome position=40.937454   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62287 62287]
−
{{#set: common name=Esi_0062_0090|Esi0062_0090}}
+
{{#set: smiles=CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)C(O)C(O)1))2))O3)}}
−
{{#set: reaction associated=ATPASE-RXN|ATPSYN-RXN}}
+
{{#set: inchi key=InChIKey=HBBOZFUQJDYASD-QGTNPELVSA-N}}
−
{{#set: pathway associated=PWY-7219}}
+
{{#set: common name=β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine}}
 +
{{#set: molecular weight=529.494   }}
 +
{{#set: common name=β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine|Lewis x epitope|Lex epitope}}
 +
{{#set: reversible reaction associated=RXN-15268}}

Latest revision as of 19:48, 21 March 2018

Metabolite CPD-16475

  • smiles:
    • CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)C(O)C(O)1))2))O3)
  • inchi key:
    • InChIKey=HBBOZFUQJDYASD-QGTNPELVSA-N
  • common name:
    • β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine
  • molecular weight:
    • 529.494
  • Synonym(s):
    • β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine
    • Lewis x epitope
    • Lex epitope

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links


"β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine" cannot be used as a page name in this wiki.
"β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-16475&oldid=29385"