Difference between revisions of "RXN0-5222"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == * smiles: ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) * inchi k...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5222 RXN0-5222] == * direction: ** LEFT-TO-RIGHT * common name: ** cyanase * Synonym(s): ** cy...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5222 RXN0-5222] ==
−
* smiles:
+
* direction:
−
** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** pyridoxine 5'-phosphate
+
** cyanase
−
* molecular weight:
+
−
** 247.144   
+
 
* Synonym(s):
 
* Synonym(s):
−
** pyridoxol 5'-phosphate
+
** cyanate lyase
−
** pyridoxine 5-phosphate
+
** cyanate hydrolase
−
** pyridoxine phosphate
+
** cyanate aminohydrolase
−
** pyridoxine-5P
+
** cyanate C-N-lyase
−
** pyridoxine-P
+
** cyanate hydratase
−
** [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[PNPOXI-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CARBAMATE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
* [[PNKIN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 carbamate[c] '''+''' 2 H+[c] '''=>''' 1 ammonium[c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[CYANCAT-PWY]], cyanate degradation: [http://metacyc.org/META/NEW-IMAGE?object=CYANCAT-PWY CYANCAT-PWY]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY0-1471]], uracil degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1471 PWY0-1471]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 447-05-2
+
* RHEA:
−
* BIGG : 35527
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15649 15649]
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24794348 24794348]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07316 R07316]
−
* HMDB : HMDB01319
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: common name=cyanase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00627 C00627]
+
{{#set: common name=cyanate lyase|cyanate hydrolase|cyanate aminohydrolase|cyanate C-N-lyase|cyanate hydratase}}
−
* CHEBI:
+
{{#set: in pathway=CYANCAT-PWY|PWY0-1471}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58589 58589]
+
{{#set: reconstruction category=annotation}}
−
* METABOLIGHTS : MTBLC58589
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L}}
+
−
{{#set: common name=pyridoxine 5'-phosphate}}
+
−
{{#set: molecular weight=247.144    }}
+
−
{{#set: common name=pyridoxol 5'-phosphate|pyridoxine 5-phosphate|pyridoxine phosphate|pyridoxine-5P|pyridoxine-P|[5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate}}
+
−
{{#set: consumed by=PNPOXI-RXN}}
+
−
{{#set: produced by=PNKIN-RXN}}
+

Latest revision as of 19:48, 21 March 2018

Reaction RXN0-5222

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cyanase
  • Synonym(s):
    • cyanate lyase
    • cyanate hydrolase
    • cyanate aminohydrolase
    • cyanate C-N-lyase
    • cyanate hydratase

Reaction Formula

Genes associated with this reaction

Pathways

  • CYANCAT-PWY, cyanate degradation: CYANCAT-PWY
    • 2 reactions found over 3 reactions in the full pathway
  • PWY0-1471, uracil degradation III: PWY0-1471
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN0-5222&oldid=29390"