Difference between revisions of "RXN0-5222"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == * smiles: ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5222 RXN0-5222] == * direction: ** LEFT-TO-RIGHT * common name: ** cyanase * Synonym(s): ** cy...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5222 RXN0-5222] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cyanase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cyanate lyase |
− | ** | + | ** cyanate hydrolase |
− | ** | + | ** cyanate aminohydrolase |
− | ** | + | ** cyanate C-N-lyase |
− | + | ** cyanate hydratase | |
− | ** | + | |
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[CARBAMATE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 carbamate[c] '''+''' 2 H+[c] '''=>''' 1 ammonium[c] '''+''' 1 CO2[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[CYANCAT-PWY]], cyanate degradation: [http://metacyc.org/META/NEW-IMAGE?object=CYANCAT-PWY CYANCAT-PWY] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY0-1471]], uracil degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1471 PWY0-1471] | ||
+ | ** '''1''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15649 15649] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07316 R07316] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=cyanase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=cyanate lyase|cyanate hydrolase|cyanate aminohydrolase|cyanate C-N-lyase|cyanate hydratase}} |
− | + | {{#set: in pathway=CYANCAT-PWY|PWY0-1471}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:48, 21 March 2018
Contents
Reaction RXN0-5222
- direction:
- LEFT-TO-RIGHT
- common name:
- cyanase
- Synonym(s):
- cyanate lyase
- cyanate hydrolase
- cyanate aminohydrolase
- cyanate C-N-lyase
- cyanate hydratase
Reaction Formula
- With identifiers:
- 1 CARBAMATE[c] + 2 PROTON[c] => 1 AMMONIUM[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 carbamate[c] + 2 H+[c] => 1 ammonium[c] + 1 CO2[c]
Genes associated with this reaction
Pathways
- CYANCAT-PWY, cyanate degradation: CYANCAT-PWY
- 2 reactions found over 3 reactions in the full pathway
- PWY0-1471, uracil degradation III: PWY0-1471
- 1 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links