Difference between revisions of "RXN-15816"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15816 RXN-15816] == * direction: ** LEFT-TO-RIGHT * common name: ** Cytochrome c1 ** ubiquinol...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15816 RXN-15816] ==
−
* smiles:
+
* direction:
−
** C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M
+
 
* common name:
 
* common name:
−
** D-gluconate
+
** Cytochrome c1
−
* molecular weight:
+
** ubiquinol cytochrome c reductase subunit QCR9
−
** 195.149   
+
** Ubiquinol cytochrome reductase, transmembrane domain
 +
** Ubiquinol-cytochrome C reductase hinge domain
 +
** Cytochrome b-c1 complex subunit 7
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.10.2.2 EC-1.10.2.2]
 
* Synonym(s):
 
* Synonym(s):
−
** D-gluconic acid
 
−
** dextronic acid
 
−
** maltonic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[GLUCONOLACT-RXN]]
+
** 1 [[ETR-Quinols]][c] '''+''' 2 [[Cytochromes-C-Oxidized]][e] '''=>''' 2 [[Cytochromes-C-Reduced]][e] '''+''' 2 [[PROTON]][c] '''+''' 1 [[ETR-Quinones]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 an electron-transfer quinol[c] '''+''' 2 an oxidized c-type cytochrome[e] '''=>''' 2 a reduced c-type cytochrome[e] '''+''' 2 H+[c] '''+''' 1 an electron-transfer quinone[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_004500]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-18_002810]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-08_003040]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-25_001440]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-01_002540]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 526-95-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 34420
+
{{#set: common name=Cytochrome c1}}
−
* PUBCHEM:
+
{{#set: common name=ubiquinol cytochrome c reductase subunit QCR9}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419706 6419706]
+
{{#set: common name=Ubiquinol cytochrome reductase, transmembrane domain}}
−
* HMDB : HMDB00625
+
{{#set: common name=Ubiquinol-cytochrome C reductase hinge domain}}
−
* LIGAND-CPD:
+
{{#set: common name=Cytochrome b-c1 complex subunit 7}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00257 C00257]
+
{{#set: ec number=EC-1.10.2.2}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Ec-21_004500|Ec-18_002810|Ec-08_003040|Ec-25_001440|Ec-01_002540}}
−
** [http://www.chemspider.com/Chemical-Structure.4925340.html 4925340]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18391 18391]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* METABOLIGHTS : MTBLC18391
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M}}
+
−
{{#set: common name=D-gluconate}}
+
−
{{#set: molecular weight=195.149    }}
+
−
{{#set: common name=D-gluconic acid|dextronic acid|maltonic acid}}
+
−
{{#set: produced by=GLUCONOLACT-RXN}}
+

Latest revision as of 20:48, 21 March 2018

Reaction RXN-15816

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Cytochrome c1
    • ubiquinol cytochrome c reductase subunit QCR9
    • Ubiquinol cytochrome reductase, transmembrane domain
    • Ubiquinol-cytochrome C reductase hinge domain
    • Cytochrome b-c1 complex subunit 7
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-15816&oldid=29393"