Difference between revisions of "CPD-409"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == * smiles: ** CS(=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=QEFRNWWLZK...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-409 CPD-409] == * common name: ** a 2-monoglyceride * Synonym(s): ** a 2-acylglycerol ** a...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-409 CPD-409] ==
* smiles:
+
** CS(=O)CCC([N+])C(=O)[O-]
+
* inchi key:
+
** InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N
+
 
* common name:
 
* common name:
** L-methionine-(R)-S-oxide
+
** a 2-monoglyceride
* molecular weight:
+
** 165.207   
+
 
* Synonym(s):
 
* Synonym(s):
** L-methionine-R-sulfoxide
+
** a 2-acylglycerol
 +
** a 2-glyceride
 +
** a 2-MAG
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.4.14-RXN]]
+
* [[RXN-1603]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-1602]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-12383]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 2-monoglyceride}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11862103 11862103]
+
{{#set: common name=a 2-acylglycerol|a 2-glyceride|a 2-MAG}}
* CHEBI:
+
{{#set: consumed by=RXN-1603}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58773 58773]
+
{{#set: produced by=RXN-1602}}
* BIGG : 2217370
+
{{#set: reversible reaction associated=RXN-12383}}
{{#set: smiles=CS(=O)CCC([N+])C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N}}
+
{{#set: common name=L-methionine-(R)-S-oxide}}
+
{{#set: molecular weight=165.207    }}
+
{{#set: common name=L-methionine-R-sulfoxide}}
+
{{#set: consumed by=1.8.4.14-RXN}}
+

Latest revision as of 19:48, 21 March 2018

Metabolite CPD-409

  • common name:
    • a 2-monoglyceride
  • Synonym(s):
    • a 2-acylglycerol
    • a 2-glyceride
    • a 2-MAG

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links