Difference between revisions of "SINAPATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D3-cis-D7-tetradecenoyl-ACPs Trans-D3-cis-D7-tetradecenoyl-ACPs] == * common name: ** a t...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] == * smiles: ** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O) * inchi key: ** InChIKe...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-D3-cis-D7-tetradecenoyl-ACPs Trans-D3-cis-D7-tetradecenoyl-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] ==
 +
* smiles:
 +
** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)
 +
* inchi key:
 +
** InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M
 
* common name:
 
* common name:
** a trans-Δ3-cis-Δ7-tetradecenoyl-[acp]
+
** sinapate
 +
* molecular weight:
 +
** 223.205   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,5-dimethoxy-4-hydroxycinnamate
 +
** sinapinate
 +
** sinapinic acid
 +
** sinapic acid
 +
** 3,5-dimethoxy-4-hydroxycinnamic acid
 +
** 4-hydroxy-3,5-dimethoxycinnamate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10657]]
+
* [[RXN-10919]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10656]]
+
* [[RXN-3422]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a trans-Δ3-cis-Δ7-tetradecenoyl-[acp]}}
+
* NCI:
{{#set: consumed by=RXN-10657}}
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=59261 59261]
{{#set: produced by=RXN-10656}}
+
* CAS : 530-59-6
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54710960 54710960]
 +
* HMDB : HMDB32616
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00482 C00482]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4573878.html 4573878]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30023 30023]
 +
{{#set: smiles=COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)}}
 +
{{#set: inchi key=InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M}}
 +
{{#set: common name=sinapate}}
 +
{{#set: molecular weight=223.205    }}
 +
{{#set: common name=3,5-dimethoxy-4-hydroxycinnamate|sinapinate|sinapinic acid|sinapic acid|3,5-dimethoxy-4-hydroxycinnamic acid|4-hydroxy-3,5-dimethoxycinnamate}}
 +
{{#set: consumed by=RXN-10919}}
 +
{{#set: produced by=RXN-3422}}

Latest revision as of 19:48, 21 March 2018

Metabolite SINAPATE

  • smiles:
    • COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)
  • inchi key:
    • InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M
  • common name:
    • sinapate
  • molecular weight:
    • 223.205
  • Synonym(s):
    • 3,5-dimethoxy-4-hydroxycinnamate
    • sinapinate
    • sinapinic acid
    • sinapic acid
    • 3,5-dimethoxy-4-hydroxycinnamic acid
    • 4-hydroxy-3,5-dimethoxycinnamate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)" cannot be used as a page name in this wiki.