Difference between revisions of "TREHALA-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TREHALA-RXN TREHALA-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Six-hairpin glycosidase...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TREHALA-RXN TREHALA-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Six-hairpin glycosidase-like |
− | * | + | ** Trehalase N-terminal fragment, family GH37 |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/3.2.1.28 EC-3.2.1.28] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[TREHALOSE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[GLC]][c] '''+''' 1 [[ALPHA-GLUCOSE]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 α,α-trehalose[c] '''+''' 1 H2O[c] '''=>''' 1 β-D-glucopyranose[c] '''+''' 1 α-D-glucopyranose[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-00_010170]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-22_000080]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY0-1182]], trehalose degradation II (trehalase): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1182 PWY0-1182] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY0-1466]], trehalose degradation VI (periplasmic): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1466 PWY0-1466] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00010 R00010] |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P19813 P19813] |
− | * | + | ** [http://www.uniprot.org/uniprot/O43280 O43280] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P13482 P13482] |
− | * | + | ** [http://www.uniprot.org/uniprot/P32359 P32359] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P32358 P32358] |
− | * | + | ** [http://www.uniprot.org/uniprot/P35172 P35172] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P62601 P62601] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P32356 P32356] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P48016 P48016] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P78922 P78922] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=Six-hairpin glycosidase-like}} |
− | {{#set: | + | {{#set: common name=Trehalase N-terminal fragment, family GH37}} |
+ | {{#set: ec number=EC-3.2.1.28}} | ||
+ | {{#set: gene associated=Ec-00_010170|Ec-22_000080}} | ||
+ | {{#set: in pathway=PWY0-1182|PWY0-1466}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:48, 21 March 2018
Contents
Reaction TREHALA-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Six-hairpin glycosidase-like
- Trehalase N-terminal fragment, family GH37
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 TREHALOSE[c] + 1 WATER[c] => 1 GLC[c] + 1 ALPHA-GLUCOSE[c]
- With common name(s):
- 1 α,α-trehalose[c] + 1 H2O[c] => 1 β-D-glucopyranose[c] + 1 α-D-glucopyranose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-00_010170
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-22_000080
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY0-1182, trehalose degradation II (trehalase): PWY0-1182
- 2 reactions found over 2 reactions in the full pathway
- PWY0-1466, trehalose degradation VI (periplasmic): PWY0-1466
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links